C15H19N3 — CID 105196567
[pyridin-4-yl-(2,4,5-trimethylphenyl)methyl]hydrazine (PubChem CID 105196567) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is [pyridin-4-yl-(2,4,5-trimethylphenyl)methyl]hydrazine.
| Compound Name | [pyridin-4-yl-(2,4,5-trimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105196567 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | [pyridin-4-yl-(2,4,5-trimethylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(C)c(C(NN)c2ccncc2)cc1C |
| InChI | InChI=1S/C15H19N3/c1-10-8-12(3)14(9-11(10)2)15(18-16)13-4-6-17-7-5-13/h4-9,15,18H,16H2,1-3H3 |
| InChIKey | QDLWUTFXQTVZHC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|