C11H9F3N2S — CID 105196682
[thiophen-3-yl-(2,3,4-trifluorophenyl)methyl]hydrazine (PubChem CID 105196682) has the molecular formula C11H9F3N2S and a molecular weight of 258.27 g/mol. Its IUPAC name is [thiophen-3-yl-(2,3,4-trifluorophenyl)methyl]hydrazine.
| Compound Name | [thiophen-3-yl-(2,3,4-trifluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105196682 |
| Molecular Formula | C11H9F3N2S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | [thiophen-3-yl-(2,3,4-trifluorophenyl)methyl]hydrazine |
| SMILES | NNC(c1ccsc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H9F3N2S/c12-8-2-1-7(9(13)10(8)14)11(16-15)6-3-4-17-5-6/h1-5,11,16H,15H2 |
| InChIKey | AUKQKBHSPQWMJK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|