About [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate
[2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate (PubChem CID 10519691) has the molecular formula C20H33NO2
and a molecular weight of 319.49 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate.
Molecular Properties
| Compound Name | [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate |
| PubChem CID | 10519691 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate |
| SMILES | CCCN(CCC)CC(=O)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C20H33NO2/c1-7-12-21(13-8-2)14-19(22)23-20-17(15(3)4)10-9-11-18(20)16(5)6/h9-11,15-16H,7-8,12-14H2,1-6H3 |
| InChIKey | MSOLJWCFBJSQMR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate?
The IUPAC name of [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate (CID 10519691) is [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate.
What is the SMILES notation for [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate?
The canonical SMILES for [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate is CCCN(CCC)CC(=O)Oc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate?
The InChIKey is MSOLJWCFBJSQMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33NO2/c1-7-12-21(13-8-2)14-19(22)23-20-17(15(3)4)10-9-11-18(20)16(5)6/h9-11,15-16H,7-8,12-14H2,1-6H3.
What are the key properties of [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate?
[2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate has a molecular weight of 319.49 g/mol, XLogP of 4.96, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-di(propan-2-yl)phenyl] 2-(dipropylamino)acetate is sourced from PubChem (CID 10519691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).