C13H15ClF2N4 — CID 105197225
[(4-chloro-1-propan-2-ylpyrazol-5-yl)-(3,4-difluorophenyl)methyl]hydrazine (PubChem CID 105197225) has the molecular formula C13H15ClF2N4 and a molecular weight of 300.74 g/mol. Its IUPAC name is [(4-chloro-1-propan-2-ylpyrazol-5-yl)-(3,4-difluorophenyl)methyl]hydrazine.
| Compound Name | [(4-chloro-1-propan-2-ylpyrazol-5-yl)-(3,4-difluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105197225 |
| Molecular Formula | C13H15ClF2N4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | [(4-chloro-1-propan-2-ylpyrazol-5-yl)-(3,4-difluorophenyl)methyl]hydrazine |
| SMILES | CC(C)n1ncc(Cl)c1C(NN)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15ClF2N4/c1-7(2)20-13(9(14)6-18-20)12(19-17)8-3-4-10(15)11(16)5-8/h3-7,12,19H,17H2,1-2H3 |
| InChIKey | VXFRCXZVXOZYHR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|