C17H24N2O4 — CID 10519739
diethyl (2R,4R)-4-amino-1-benzylpyrrolidine-2,4-dicarboxylate (PubChem CID 10519739) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is diethyl (2R,4R)-4-amino-1-benzylpyrrolidine-2,4-dicarboxylate.
| Compound Name | diethyl (2R,4R)-4-amino-1-benzylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 10519739 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | diethyl (2R,4R)-4-amino-1-benzylpyrrolidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@](N)(C(=O)OCC)CN1Cc1ccccc1 |
| InChI | InChI=1S/C17H24N2O4/c1-3-22-15(20)14-10-17(18,16(21)23-4-2)12-19(14)11-13-8-6-5-7-9-13/h5-9,14H,3-4,10-12,18H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | OYQUDSOGMHYDBL-RHSMWYFYSA-N |
| XLogP | 1.08 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |