C18H24N2 — CID 105197416
[2-(2,6-dimethylphenyl)-1-(4-ethylphenyl)ethyl]hydrazine (PubChem CID 105197416) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is [2-(2,6-dimethylphenyl)-1-(4-ethylphenyl)ethyl]hydrazine.
| Compound Name | [2-(2,6-dimethylphenyl)-1-(4-ethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105197416 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | [2-(2,6-dimethylphenyl)-1-(4-ethylphenyl)ethyl]hydrazine |
| SMILES | CCc1ccc(C(Cc2c(C)cccc2C)NN)cc1 |
| InChI | InChI=1S/C18H24N2/c1-4-15-8-10-16(11-9-15)18(20-19)12-17-13(2)6-5-7-14(17)3/h5-11,18,20H,4,12,19H2,1-3H3 |
| InChIKey | WHWQRJRNMJNCFH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|