C17H22N2O2 — CID 105197445
[(2,5-dimethoxyphenyl)-(4-ethylphenyl)methyl]hydrazine (PubChem CID 105197445) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is [(2,5-dimethoxyphenyl)-(4-ethylphenyl)methyl]hydrazine.
| Compound Name | [(2,5-dimethoxyphenyl)-(4-ethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105197445 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | [(2,5-dimethoxyphenyl)-(4-ethylphenyl)methyl]hydrazine |
| SMILES | CCc1ccc(C(NN)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C17H22N2O2/c1-4-12-5-7-13(8-6-12)17(19-18)15-11-14(20-2)9-10-16(15)21-3/h5-11,17,19H,4,18H2,1-3H3 |
| InChIKey | NSHNYTAAYLTSPU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|