C17H19FN2 — CID 105198387
[1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-3-(4-fluorophenyl)propan-2-yl]hydrazine (PubChem CID 105198387) has the molecular formula C17H19FN2 and a molecular weight of 270.35 g/mol. Its IUPAC name is [1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-3-(4-fluorophenyl)propan-2-yl]hydrazine.
| Compound Name | [1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-3-(4-fluorophenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105198387 |
| Molecular Formula | C17H19FN2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-3-(4-fluorophenyl)propan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccc(F)cc1)CC1Cc2ccccc21 |
| InChI | InChI=1S/C17H19FN2/c18-15-7-5-12(6-8-15)9-16(20-19)11-14-10-13-3-1-2-4-17(13)14/h1-8,14,16,20H,9-11,19H2 |
| InChIKey | CKURNMDOGPXQPK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|