C14H11ClN2O3S — CID 10519913
1-[(4-chlorophenyl)methyl]-2,2-dioxo-2λ6,1,3-benzothiadiazin-4-one (PubChem CID 10519913) has the molecular formula C14H11ClN2O3S and a molecular weight of 322.77 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2,2-dioxo-2λ6,1,3-benzothiadiazin-4-one.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2,2-dioxo-2λ6,1,3-benzothiadiazin-4-one |
|---|---|
| PubChem CID | 10519913 |
| Molecular Formula | C14H11ClN2O3S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2,2-dioxo-2λ6,1,3-benzothiadiazin-4-one |
| SMILES | O=C1NS(=O)(=O)N(Cc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C14H11ClN2O3S/c15-11-7-5-10(6-8-11)9-17-13-4-2-1-3-12(13)14(18)16-21(17,19)20/h1-8H,9H2,(H,16,18) |
| InChIKey | CLPIWODOQQJNGE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |