C15H21N3O3S — CID 10519965
N-(diaminomethylidene)-2,2,4,6-tetramethyl-1,1-dioxo-3,4-dihydrothiochromene-7-carboxamide (PubChem CID 10519965) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,2,4,6-tetramethyl-1,1-dioxo-3,4-dihydrothiochromene-7-carboxamide.
| Compound Name | N-(diaminomethylidene)-2,2,4,6-tetramethyl-1,1-dioxo-3,4-dihydrothiochromene-7-carboxamide |
|---|---|
| PubChem CID | 10519965 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-(diaminomethylidene)-2,2,4,6-tetramethyl-1,1-dioxo-3,4-dihydrothiochromene-7-carboxamide |
| SMILES | Cc1cc2c(cc1C(=O)N=C(N)N)S(=O)(=O)C(C)(C)CC2C |
| InChI | InChI=1S/C15H21N3O3S/c1-8-5-10-9(2)7-15(3,4)22(20,21)12(10)6-11(8)13(19)18-14(16)17/h5-6,9H,7H2,1-4H3,(H4,16,17,18,19) |
| InChIKey | KVPDMRAVMLLLSD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|