C22H29NO — CID 10519978
2,2,4,6,7-pentamethyl-3-(4-propan-2-ylphenyl)-3H-1-benzofuran-5-amine (PubChem CID 10519978) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 2,2,4,6,7-pentamethyl-3-(4-propan-2-ylphenyl)-3H-1-benzofuran-5-amine.
| Compound Name | 2,2,4,6,7-pentamethyl-3-(4-propan-2-ylphenyl)-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10519978 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 2,2,4,6,7-pentamethyl-3-(4-propan-2-ylphenyl)-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)C(c1ccc(C(C)C)cc1)C(C)(C)O2 |
| InChI | InChI=1S/C22H29NO/c1-12(2)16-8-10-17(11-9-16)19-18-15(5)20(23)13(3)14(4)21(18)24-22(19,6)7/h8-12,19H,23H2,1-7H3 |
| InChIKey | IOVTUBAWFXTQCT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|