C14H15F2N3 — CID 105199804
[1-(2,5-difluorophenyl)-3-pyridin-2-ylpropan-2-yl]hydrazine (PubChem CID 105199804) has the molecular formula C14H15F2N3 and a molecular weight of 263.29 g/mol. Its IUPAC name is [1-(2,5-difluorophenyl)-3-pyridin-2-ylpropan-2-yl]hydrazine.
| Compound Name | [1-(2,5-difluorophenyl)-3-pyridin-2-ylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105199804 |
| Molecular Formula | C14H15F2N3 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [1-(2,5-difluorophenyl)-3-pyridin-2-ylpropan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccccn1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C14H15F2N3/c15-11-4-5-14(16)10(7-11)8-13(19-17)9-12-3-1-2-6-18-12/h1-7,13,19H,8-9,17H2 |
| InChIKey | BSKZVZANKOJNCI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|