About pentadecan-3-ylhydrazine
pentadecan-3-ylhydrazine (PubChem CID 105200968) has the molecular formula C15H34N2
and a molecular weight of 242.45 g/mol. Its IUPAC name is pentadecan-3-ylhydrazine.
Molecular Properties
| Compound Name | pentadecan-3-ylhydrazine |
| PubChem CID | 105200968 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | pentadecan-3-ylhydrazine |
| SMILES | CCCCCCCCCCCCC(CC)NN |
| InChI | InChI=1S/C15H34N2/c1-3-5-6-7-8-9-10-11-12-13-14-15(4-2)17-16/h15,17H,3-14,16H2,1-2H3 |
| InChIKey | FGIDWSIQFUTASU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pentadecan-3-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadecan-3-ylhydrazine?
The IUPAC name of pentadecan-3-ylhydrazine (CID 105200968) is pentadecan-3-ylhydrazine.
What is the SMILES notation for pentadecan-3-ylhydrazine?
The canonical SMILES for pentadecan-3-ylhydrazine is CCCCCCCCCCCCC(CC)NN.
What is the InChIKey of pentadecan-3-ylhydrazine?
The InChIKey is FGIDWSIQFUTASU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H34N2/c1-3-5-6-7-8-9-10-11-12-13-14-15(4-2)17-16/h15,17H,3-14,16H2,1-2H3.
What are the key properties of pentadecan-3-ylhydrazine?
pentadecan-3-ylhydrazine has a molecular weight of 242.45 g/mol, XLogP of 4.54, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentadecan-3-ylhydrazine is sourced from PubChem (CID 105200968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).