C15H11N5S2 — CID 10520111
14,16-dimethyl-19-thia-2,4,5,11,17-pentazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),5,7,9,13(18),14,16-heptaene-3-thione (PubChem CID 10520111) has the molecular formula C15H11N5S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 14,16-dimethyl-19-thia-2,4,5,11,17-pentazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),5,7,9,13(18),14,16-heptaene-3-thione.
| Compound Name | 14,16-dimethyl-19-thia-2,4,5,11,17-pentazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),5,7,9,13(18),14,16-heptaene-3-thione |
|---|---|
| PubChem CID | 10520111 |
| Molecular Formula | C15H11N5S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 14,16-dimethyl-19-thia-2,4,5,11,17-pentazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),5,7,9,13(18),14,16-heptaene-3-thione |
| SMILES | Cc1cc(C)c2c(n1)sc1c2n2cccc2c2n[nH]c(=S)n21 |
| InChI | InChI=1S/C15H11N5S2/c1-7-6-8(2)16-13-10(7)11-14(22-13)20-12(17-18-15(20)21)9-4-3-5-19(9)11/h3-6H,1-2H3,(H,18,21) |
| InChIKey | HOTUUQJRINWXJO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|