C9H18N4 — CID 105201388
1-(3-ethyl-1-methylpyrazol-5-yl)propan-2-ylhydrazine (PubChem CID 105201388) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-(3-ethyl-1-methylpyrazol-5-yl)propan-2-ylhydrazine.
| Compound Name | 1-(3-ethyl-1-methylpyrazol-5-yl)propan-2-ylhydrazine |
|---|---|
| PubChem CID | 105201388 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 1-(3-ethyl-1-methylpyrazol-5-yl)propan-2-ylhydrazine |
| SMILES | CCc1cc(CC(C)NN)n(C)n1 |
| InChI | InChI=1S/C9H18N4/c1-4-8-6-9(13(3)12-8)5-7(2)11-10/h6-7,11H,4-5,10H2,1-3H3 |
| InChIKey | OWFQAHFMUNCXHC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|