About (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine
(1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine (PubChem CID 105201793) has the molecular formula C11H21F3N2
and a molecular weight of 238.30 g/mol. Its IUPAC name is (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine.
Molecular Properties
| Compound Name | (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine |
| PubChem CID | 105201793 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine |
| SMILES | NNC(CCCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H21F3N2/c12-11(13,14)8-4-7-10(16-15)9-5-2-1-3-6-9/h9-10,16H,1-8,15H2 |
| InChIKey | HLEOQAIAJRSPHM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine?
The IUPAC name of (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine (CID 105201793) is (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine.
What is the SMILES notation for (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine?
The canonical SMILES for (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine is NNC(CCCC(F)(F)F)C1CCCCC1.
What is the InChIKey of (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine?
The InChIKey is HLEOQAIAJRSPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2/c12-11(13,14)8-4-7-10(16-15)9-5-2-1-3-6-9/h9-10,16H,1-8,15H2.
What are the key properties of (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine?
(1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine has a molecular weight of 238.30 g/mol, XLogP of 3.13, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexyl-5,5,5-trifluoropentyl)hydrazine is sourced from PubChem (CID 105201793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).