C18H24N2 — CID 105201891
(1-cyclohexyl-2-naphthalen-1-ylethyl)hydrazine (PubChem CID 105201891) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (1-cyclohexyl-2-naphthalen-1-ylethyl)hydrazine.
| Compound Name | (1-cyclohexyl-2-naphthalen-1-ylethyl)hydrazine |
|---|---|
| PubChem CID | 105201891 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (1-cyclohexyl-2-naphthalen-1-ylethyl)hydrazine |
| SMILES | NNC(Cc1cccc2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C18H24N2/c19-20-18(15-8-2-1-3-9-15)13-16-11-6-10-14-7-4-5-12-17(14)16/h4-7,10-12,15,18,20H,1-3,8-9,13,19H2 |
| InChIKey | FWMDYBSIQSPVCM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|