C19H38O2Si — CID 10520217
tert-butyl-[(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl]oxy-dimethylsilane (PubChem CID 10520217) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is tert-butyl-[(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10520217 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | tert-butyl-[(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-yl]oxy-dimethylsilane |
| SMILES | C/C(=C\CCC(C)O[Si](C)(C)C(C)(C)C)CCC1OC1(C)C |
| InChI | InChI=1S/C19H38O2Si/c1-15(13-14-17-19(6,7)20-17)11-10-12-16(2)21-22(8,9)18(3,4)5/h11,16-17H,10,12-14H2,1-9H3/b15-11+ |
| InChIKey | LVZCYWNYGNBJIO-RVDMUPIBSA-N |
| XLogP | 6.08 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|