About 11-nitroquinoxalino[2,3-f][1,10]phenanthroline
11-nitroquinoxalino[2,3-f][1,10]phenanthroline (PubChem CID 10520237) has the molecular formula C18H9N5O2
and a molecular weight of 327.30 g/mol. Its IUPAC name is 11-nitroquinoxalino[2,3-f][1,10]phenanthroline.
Molecular Properties
| Compound Name | 11-nitroquinoxalino[2,3-f][1,10]phenanthroline |
| PubChem CID | 10520237 |
| Molecular Formula | C18H9N5O2 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 11-nitroquinoxalino[2,3-f][1,10]phenanthroline |
| SMILES | O=[N+]([O-])c1ccc2nc3c4cccnc4c4ncccc4c3nc2c1 |
| InChI | InChI=1S/C18H9N5O2/c24-23(25)10-5-6-13-14(9-10)22-18-12-4-2-8-20-16(12)15-11(17(18)21-13)3-1-7-19-15/h1-9H |
| InChIKey | KKIQKNNKSNXDNT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 11-nitroquinoxalino[2,3-f][1,10]phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-nitroquinoxalino[2,3-f][1,10]phenanthroline?
The IUPAC name of 11-nitroquinoxalino[2,3-f][1,10]phenanthroline (CID 10520237) is 11-nitroquinoxalino[2,3-f][1,10]phenanthroline.
What is the SMILES notation for 11-nitroquinoxalino[2,3-f][1,10]phenanthroline?
The canonical SMILES for 11-nitroquinoxalino[2,3-f][1,10]phenanthroline is O=[N+]([O-])c1ccc2nc3c4cccnc4c4ncccc4c3nc2c1.
What is the InChIKey of 11-nitroquinoxalino[2,3-f][1,10]phenanthroline?
The InChIKey is KKIQKNNKSNXDNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9N5O2/c24-23(25)10-5-6-13-14(9-10)22-18-12-4-2-8-20-16(12)15-11(17(18)21-13)3-1-7-19-15/h1-9H.
What are the key properties of 11-nitroquinoxalino[2,3-f][1,10]phenanthroline?
11-nitroquinoxalino[2,3-f][1,10]phenanthroline has a molecular weight of 327.30 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 11-nitroquinoxalino[2,3-f][1,10]phenanthroline is sourced from PubChem (CID 10520237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).