C19H21NO4 — CID 10520252
benzyl (5S,8aS,8bS)-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 10520252) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is benzyl (5S,8aS,8bS)-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | benzyl (5S,8aS,8bS)-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 10520252 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | benzyl (5S,8aS,8bS)-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | CO[C@H]1CCC[C@H]2C1=C(C(=O)OCc1ccccc1)N1C(=O)C[C@@H]21 |
| InChI | InChI=1S/C19H21NO4/c1-23-15-9-5-8-13-14-10-16(21)20(14)18(17(13)15)19(22)24-11-12-6-3-2-4-7-12/h2-4,6-7,13-15H,5,8-11H2,1H3/t13-,14+,15+/m1/s1 |
| InChIKey | PDEPVGPHNRLWJU-ILXRZTDVSA-N |
| XLogP | 2.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |