C11H22N4 — CID 105203000
[2,2-dimethyl-1-(1-propylpyrazol-4-yl)propyl]hydrazine (PubChem CID 105203000) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is [2,2-dimethyl-1-(1-propylpyrazol-4-yl)propyl]hydrazine.
| Compound Name | [2,2-dimethyl-1-(1-propylpyrazol-4-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105203000 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | [2,2-dimethyl-1-(1-propylpyrazol-4-yl)propyl]hydrazine |
| SMILES | CCCn1cc(C(NN)C(C)(C)C)cn1 |
| InChI | InChI=1S/C11H22N4/c1-5-6-15-8-9(7-13-15)10(14-12)11(2,3)4/h7-8,10,14H,5-6,12H2,1-4H3 |
| InChIKey | YKDNAWRUVBBWCJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|