C14H13F3N2 — CID 105204059
[(2,3-difluorophenyl)-(4-fluoro-3-methylphenyl)methyl]hydrazine (PubChem CID 105204059) has the molecular formula C14H13F3N2 and a molecular weight of 266.27 g/mol. Its IUPAC name is [(2,3-difluorophenyl)-(4-fluoro-3-methylphenyl)methyl]hydrazine.
| Compound Name | [(2,3-difluorophenyl)-(4-fluoro-3-methylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105204059 |
| Molecular Formula | C14H13F3N2 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | [(2,3-difluorophenyl)-(4-fluoro-3-methylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2cccc(F)c2F)ccc1F |
| InChI | InChI=1S/C14H13F3N2/c1-8-7-9(5-6-11(8)15)14(19-18)10-3-2-4-12(16)13(10)17/h2-7,14,19H,18H2,1H3 |
| InChIKey | HACIAOAVQRGNHF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|