C11H20N2O — CID 105204260
[cyclopentyl(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine (PubChem CID 105204260) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is [cyclopentyl(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine.
| Compound Name | [cyclopentyl(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105204260 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | [cyclopentyl(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine |
| SMILES | NNC(C1=COCCC1)C1CCCC1 |
| InChI | InChI=1S/C11H20N2O/c12-13-11(9-4-1-2-5-9)10-6-3-7-14-8-10/h8-9,11,13H,1-7,12H2 |
| InChIKey | PYOHHZVODPBGLT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|