About (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine
(6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine (PubChem CID 105205912) has the molecular formula C8H17F3N2O2S
and a molecular weight of 262.30 g/mol. Its IUPAC name is (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine.
Molecular Properties
| Compound Name | (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine |
| PubChem CID | 105205912 |
| Molecular Formula | C8H17F3N2O2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine |
| SMILES | CCS(=O)(=O)CCCC(CC(F)(F)F)NN |
| InChI | InChI=1S/C8H17F3N2O2S/c1-2-16(14,15)5-3-4-7(13-12)6-8(9,10)11/h7,13H,2-6,12H2,1H3 |
| InChIKey | BJJUTIFARATLLL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine?
The IUPAC name of (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine (CID 105205912) is (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine.
What is the SMILES notation for (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine?
The canonical SMILES for (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine is CCS(=O)(=O)CCCC(CC(F)(F)F)NN.
What is the InChIKey of (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine?
The InChIKey is BJJUTIFARATLLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F3N2O2S/c1-2-16(14,15)5-3-4-7(13-12)6-8(9,10)11/h7,13H,2-6,12H2,1H3.
What are the key properties of (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine?
(6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine has a molecular weight of 262.30 g/mol, XLogP of 0.99, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethylsulfonyl-1,1,1-trifluorohexan-3-yl)hydrazine is sourced from PubChem (CID 105205912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).