About [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine
[3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine (PubChem CID 105206056) has the molecular formula C10H19F3N2O2S
and a molecular weight of 288.34 g/mol. Its IUPAC name is [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine.
Molecular Properties
| Compound Name | [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine |
| PubChem CID | 105206056 |
| Molecular Formula | C10H19F3N2O2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine |
| SMILES | CS(=O)(=O)C1CCCC(C(CC(F)(F)F)NN)C1 |
| InChI | InChI=1S/C10H19F3N2O2S/c1-18(16,17)8-4-2-3-7(5-8)9(15-14)6-10(11,12)13/h7-9,15H,2-6,14H2,1H3 |
| InChIKey | ZWTOJQGURXUMAD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine?
The IUPAC name of [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine (CID 105206056) is [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine.
What is the SMILES notation for [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine?
The canonical SMILES for [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine is CS(=O)(=O)C1CCCC(C(CC(F)(F)F)NN)C1.
What is the InChIKey of [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine?
The InChIKey is ZWTOJQGURXUMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O2S/c1-18(16,17)8-4-2-3-7(5-8)9(15-14)6-10(11,12)13/h7-9,15H,2-6,14H2,1H3.
What are the key properties of [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine?
[3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine has a molecular weight of 288.34 g/mol, XLogP of 1.37, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3,3-trifluoro-1-(3-methylsulfonylcyclohexyl)propyl]hydrazine is sourced from PubChem (CID 105206056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).