C15H14Cl2F2N2 — CID 105206757
[1-(2,4-dichlorophenyl)-3-(3,5-difluorophenyl)propan-2-yl]hydrazine (PubChem CID 105206757) has the molecular formula C15H14Cl2F2N2 and a molecular weight of 331.19 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-3-(3,5-difluorophenyl)propan-2-yl]hydrazine.
| Compound Name | [1-(2,4-dichlorophenyl)-3-(3,5-difluorophenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105206757 |
| Molecular Formula | C15H14Cl2F2N2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-3-(3,5-difluorophenyl)propan-2-yl]hydrazine |
| SMILES | NNC(Cc1cc(F)cc(F)c1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2F2N2/c16-11-2-1-10(15(17)7-11)6-14(21-20)5-9-3-12(18)8-13(19)4-9/h1-4,7-8,14,21H,5-6,20H2 |
| InChIKey | QDCVKHNOJAZPJV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|