C9H14BrN3O — CID 105207194
[1-(5-bromo-2-pyridinyl)-3-methoxypropan-2-yl]hydrazine (PubChem CID 105207194) has the molecular formula C9H14BrN3O and a molecular weight of 260.13 g/mol. Its IUPAC name is [1-(5-bromo-2-pyridinyl)-3-methoxypropan-2-yl]hydrazine.
| Compound Name | [1-(5-bromo-2-pyridinyl)-3-methoxypropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105207194 |
| Molecular Formula | C9H14BrN3O |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | [1-(5-bromo-2-pyridinyl)-3-methoxypropan-2-yl]hydrazine |
| SMILES | COCC(Cc1ccc(Br)cn1)NN |
| InChI | InChI=1S/C9H14BrN3O/c1-14-6-9(13-11)4-8-3-2-7(10)5-12-8/h2-3,5,9,13H,4,6,11H2,1H3 |
| InChIKey | ZBYTUNWHRDYZED-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|