C12H16F2N2 — CID 105207885
[2-cyclobutyl-1-(3,5-difluorophenyl)ethyl]hydrazine (PubChem CID 105207885) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is [2-cyclobutyl-1-(3,5-difluorophenyl)ethyl]hydrazine.
| Compound Name | [2-cyclobutyl-1-(3,5-difluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105207885 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | [2-cyclobutyl-1-(3,5-difluorophenyl)ethyl]hydrazine |
| SMILES | NNC(CC1CCC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2N2/c13-10-5-9(6-11(14)7-10)12(16-15)4-8-2-1-3-8/h5-8,12,16H,1-4,15H2 |
| InChIKey | PBQPHOZWCHELEF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|