C13H14ClF3N4 — CID 105208071
[(4-chloro-1-propylpyrazol-5-yl)-(3,4,5-trifluorophenyl)methyl]hydrazine (PubChem CID 105208071) has the molecular formula C13H14ClF3N4 and a molecular weight of 318.73 g/mol. Its IUPAC name is [(4-chloro-1-propylpyrazol-5-yl)-(3,4,5-trifluorophenyl)methyl]hydrazine.
| Compound Name | [(4-chloro-1-propylpyrazol-5-yl)-(3,4,5-trifluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105208071 |
| Molecular Formula | C13H14ClF3N4 |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [(4-chloro-1-propylpyrazol-5-yl)-(3,4,5-trifluorophenyl)methyl]hydrazine |
| SMILES | CCCn1ncc(Cl)c1C(NN)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H14ClF3N4/c1-2-3-21-13(8(14)6-19-21)12(20-18)7-4-9(15)11(17)10(16)5-7/h4-6,12,20H,2-3,18H2,1H3 |
| InChIKey | ONZJYEIXOFZBSG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|