C14H12F3IN2 — CID 105208110
[2-(4-iodophenyl)-1-(3,4,5-trifluorophenyl)ethyl]hydrazine (PubChem CID 105208110) has the molecular formula C14H12F3IN2 and a molecular weight of 392.16 g/mol. Its IUPAC name is [2-(4-iodophenyl)-1-(3,4,5-trifluorophenyl)ethyl]hydrazine.
| Compound Name | [2-(4-iodophenyl)-1-(3,4,5-trifluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105208110 |
| Molecular Formula | C14H12F3IN2 |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | [2-(4-iodophenyl)-1-(3,4,5-trifluorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(I)cc1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H12F3IN2/c15-11-6-9(7-12(16)14(11)17)13(20-19)5-8-1-3-10(18)4-2-8/h1-4,6-7,13,20H,5,19H2 |
| InChIKey | JWIUWDJEAQBMOR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|