About [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate
[(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate (PubChem CID 10520842) has the molecular formula C14H15F3O4S
and a molecular weight of 336.33 g/mol. Its IUPAC name is [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate |
| PubChem CID | 10520842 |
| Molecular Formula | C14H15F3O4S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate |
| SMILES | CCC/C=C(\OS(=O)(=O)c1ccc(C)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H15F3O4S/c1-3-4-5-12(13(18)14(15,16)17)21-22(19,20)11-8-6-10(2)7-9-11/h5-9H,3-4H2,1-2H3/b12-5- |
| InChIKey | GIIIQOXERUXTBG-XGICHPGQSA-N |
| XLogP | 3.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate?
The IUPAC name of [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate (CID 10520842) is [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate.
What is the SMILES notation for [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate?
The canonical SMILES for [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate is CCC/C=C(\OS(=O)(=O)c1ccc(C)cc1)C(=O)C(F)(F)F.
What is the InChIKey of [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate?
The InChIKey is GIIIQOXERUXTBG-XGICHPGQSA-N. The full InChI is InChI=1S/C14H15F3O4S/c1-3-4-5-12(13(18)14(15,16)17)21-22(19,20)11-8-6-10(2)7-9-11/h5-9H,3-4H2,1-2H3/b12-5-.
What are the key properties of [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate?
[(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate has a molecular weight of 336.33 g/mol, XLogP of 3.52, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1,1,1-trifluoro-2-oxohept-3-en-3-yl] 4-methylbenzenesulfonate is sourced from PubChem (CID 10520842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).