C10H20N2O2 — CID 105209902
[1-(3,4-dihydro-2H-pyran-5-yl)-2-propoxyethyl]hydrazine (PubChem CID 105209902) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-5-yl)-2-propoxyethyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-pyran-5-yl)-2-propoxyethyl]hydrazine |
|---|---|
| PubChem CID | 105209902 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-5-yl)-2-propoxyethyl]hydrazine |
| SMILES | CCCOCC(NN)C1=COCCC1 |
| InChI | InChI=1S/C10H20N2O2/c1-2-5-13-8-10(12-11)9-4-3-6-14-7-9/h7,10,12H,2-6,8,11H2,1H3 |
| InChIKey | VAQINISGPUWXMH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|