C21H25NO3 — CID 10521058
2-(1,3-benzodioxol-5-yl)-N-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]ethanamine (PubChem CID 10521058) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]ethanamine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 10521058 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]ethanamine |
| SMILES | COc1cccc2c1CCC[C@H]2CNCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H25NO3/c1-23-19-7-3-5-17-16(4-2-6-18(17)19)13-22-11-10-15-8-9-20-21(12-15)25-14-24-20/h3,5,7-9,12,16,22H,2,4,6,10-11,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | GXYVQBPIOVUKHG-INIZCTEOSA-N |
| XLogP | 3.68 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|