C18H32O4Si — CID 10521145
(5S,6S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-4,7-dioxadispiro[4.0.46.45]tetradecan-11-one (PubChem CID 10521145) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (5S,6S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-4,7-dioxadispiro[4.0.46.45]tetradecan-11-one.
| Compound Name | (5S,6S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-4,7-dioxadispiro[4.0.46.45]tetradecan-11-one |
|---|---|
| PubChem CID | 10521145 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (5S,6S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-4,7-dioxadispiro[4.0.46.45]tetradecan-11-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@]2(CCCO2)[C@@]2(CCCO2)C1=O |
| InChI | InChI=1S/C18H32O4Si/c1-16(2,3)23(4,5)22-14-8-11-17(9-6-12-20-17)18(15(14)19)10-7-13-21-18/h14H,6-13H2,1-5H3/t14-,17+,18-/m1/s1 |
| InChIKey | CGOFNONQBVUREP-FHLIZLRMSA-N |
| XLogP | 3.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|