C19H36O3Si — CID 10521151
(3R,4aS,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4a,7,7-trimethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one (PubChem CID 10521151) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is (3R,4aS,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4a,7,7-trimethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one.
| Compound Name | (3R,4aS,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4a,7,7-trimethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 10521151 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (3R,4aS,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4a,7,7-trimethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one |
| SMILES | CC1(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)C[C@@H](O)CC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C19H36O3Si/c1-17(2,3)23(7,8)22-16-12-18(4,5)11-14-15(21)9-13(20)10-19(14,16)6/h13-14,16,20H,9-12H2,1-8H3/t13-,14-,16-,19-/m0/s1 |
| InChIKey | CYNBNUPXILPKOK-PWDMQXDWSA-N |
| XLogP | 4.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|