C17H21N3 — CID 105212360
[1-(3-cyclobutylphenyl)-2-pyridin-4-ylethyl]hydrazine (PubChem CID 105212360) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is [1-(3-cyclobutylphenyl)-2-pyridin-4-ylethyl]hydrazine.
| Compound Name | [1-(3-cyclobutylphenyl)-2-pyridin-4-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105212360 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | [1-(3-cyclobutylphenyl)-2-pyridin-4-ylethyl]hydrazine |
| SMILES | NNC(Cc1ccncc1)c1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C17H21N3/c18-20-17(11-13-7-9-19-10-8-13)16-6-2-5-15(12-16)14-3-1-4-14/h2,5-10,12,14,17,20H,1,3-4,11,18H2 |
| InChIKey | YLQHHJZCEYMHQS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|