C20H26N2O3 — CID 10521263
6-[5-[(Z)-(3,4-dimethyl-5-oxopyrrol-2-ylidene)methyl]-3,4-dimethyl-1H-pyrrol-2-yl]hept-6-enoic acid (PubChem CID 10521263) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 6-[5-[(Z)-(3,4-dimethyl-5-oxopyrrol-2-ylidene)methyl]-3,4-dimethyl-1H-pyrrol-2-yl]hept-6-enoic acid.
| Compound Name | 6-[5-[(Z)-(3,4-dimethyl-5-oxopyrrol-2-ylidene)methyl]-3,4-dimethyl-1H-pyrrol-2-yl]hept-6-enoic acid |
|---|---|
| PubChem CID | 10521263 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 6-[5-[(Z)-(3,4-dimethyl-5-oxopyrrol-2-ylidene)methyl]-3,4-dimethyl-1H-pyrrol-2-yl]hept-6-enoic acid |
| SMILES | C=C(CCCCC(=O)O)c1[nH]c(/C=C2\NC(=O)C(C)=C2C)c(C)c1C |
| InChI | InChI=1S/C20H26N2O3/c1-11(8-6-7-9-18(23)24)19-14(4)12(2)16(21-19)10-17-13(3)15(5)20(25)22-17/h10,21H,1,6-9H2,2-5H3,(H,22,25)(H,23,24)/b17-10- |
| InChIKey | FAWVWBSAIKYTKK-YVLHZVERSA-N |
| XLogP | 4.10 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|