C16H20N4O — CID 105213713
[1-(furan-2-yl)-2-(1-propylbenzimidazol-2-yl)ethyl]hydrazine (PubChem CID 105213713) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is [1-(furan-2-yl)-2-(1-propylbenzimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(furan-2-yl)-2-(1-propylbenzimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105213713 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [1-(furan-2-yl)-2-(1-propylbenzimidazol-2-yl)ethyl]hydrazine |
| SMILES | CCCn1c(CC(NN)c2ccco2)nc2ccccc21 |
| InChI | InChI=1S/C16H20N4O/c1-2-9-20-14-7-4-3-6-12(14)18-16(20)11-13(19-17)15-8-5-10-21-15/h3-8,10,13,19H,2,9,11,17H2,1H3 |
| InChIKey | YVZNIXSITWYKBF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|