C18H20N2O5 — CID 10521372
5-methoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-2H-indazol-3-one (PubChem CID 10521372) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 5-methoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-2H-indazol-3-one.
| Compound Name | 5-methoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-2H-indazol-3-one |
|---|---|
| PubChem CID | 10521372 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 5-methoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-2H-indazol-3-one |
| SMILES | COc1ccc2c(c1)c(=O)[nH]n2Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-22-12-5-6-14-13(9-12)18(21)19-20(14)10-11-7-15(23-2)17(25-4)16(8-11)24-3/h5-9H,10H2,1-4H3,(H,19,21) |
| InChIKey | GFSMDRDTSMFTDI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |