C21H28O4 — CID 10521383
(1S,4S,5R,8S,12R,13S)-5-methyl-1-(2-phenylethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10521383) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (1S,4S,5R,8S,12R,13S)-5-methyl-1-(2-phenylethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,4S,5R,8S,12R,13S)-5-methyl-1-(2-phenylethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10521383 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (1S,4S,5R,8S,12R,13S)-5-methyl-1-(2-phenylethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CC[C@H]2CCO[C@@H]3O[C@@]4(CCc5ccccc5)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C21H28O4/c1-15-7-8-17-11-14-22-19-21(17)18(15)10-13-20(23-19,24-25-21)12-9-16-5-3-2-4-6-16/h2-6,15,17-19H,7-14H2,1H3/t15-,17+,18+,19-,20-,21+/m1/s1 |
| InChIKey | GNMPJEQAJJPREJ-RPFUTYDWSA-N |
| XLogP | 4.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|