C12H18N2OS — CID 105214067
[1-(3,4-dihydro-2H-chromen-8-yl)-2-methylsulfanylethyl]hydrazine (PubChem CID 105214067) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-chromen-8-yl)-2-methylsulfanylethyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-chromen-8-yl)-2-methylsulfanylethyl]hydrazine |
|---|---|
| PubChem CID | 105214067 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | [1-(3,4-dihydro-2H-chromen-8-yl)-2-methylsulfanylethyl]hydrazine |
| SMILES | CSCC(NN)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C12H18N2OS/c1-16-8-11(14-13)10-6-2-4-9-5-3-7-15-12(9)10/h2,4,6,11,14H,3,5,7-8,13H2,1H3 |
| InChIKey | HIEUKPNCRPNLCD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|