C13H10Cl2N2O5 — CID 10521423
2-[3-[2-(3,4-dichlorophenyl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid (PubChem CID 10521423) has the molecular formula C13H10Cl2N2O5 and a molecular weight of 345.14 g/mol. Its IUPAC name is 2-[3-[2-(3,4-dichlorophenyl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[3-[2-(3,4-dichlorophenyl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10521423 |
| Molecular Formula | C13H10Cl2N2O5 |
| Molecular Weight | 345.14 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 2-[3-[2-(3,4-dichlorophenyl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)N(CCc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C13H10Cl2N2O5/c14-8-2-1-7(5-9(8)15)3-4-16-11(20)12(21)17(13(16)22)6-10(18)19/h1-2,5H,3-4,6H2,(H,18,19) |
| InChIKey | CQKCKPJRKPLPIK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|