C23H23NO2 — CID 10521456
ethyl 2-[7-[(E)-2-(4-cyanophenyl)ethenyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate (PubChem CID 10521456) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl 2-[7-[(E)-2-(4-cyanophenyl)ethenyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | ethyl 2-[7-[(E)-2-(4-cyanophenyl)ethenyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 10521456 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | ethyl 2-[7-[(E)-2-(4-cyanophenyl)ethenyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
| SMILES | CCOC(=O)CC1CCc2ccc(/C=C/c3ccc(C#N)cc3)cc2C1 |
| InChI | InChI=1S/C23H23NO2/c1-2-26-23(25)15-20-10-12-21-11-9-18(13-22(21)14-20)6-3-17-4-7-19(16-24)8-5-17/h3-9,11,13,20H,2,10,12,14-15H2,1H3/b6-3+ |
| InChIKey | MPZBMPAXRQQTPJ-ZZXKWVIFSA-N |
| XLogP | 4.79 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|