C20H26O5 — CID 10521516
(1R,5S,8S,9S,11S,12S)-5-hydroxy-11,12-dimethyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid (PubChem CID 10521516) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1R,5S,8S,9S,11S,12S)-5-hydroxy-11,12-dimethyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid.
| Compound Name | (1R,5S,8S,9S,11S,12S)-5-hydroxy-11,12-dimethyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
|---|---|
| PubChem CID | 10521516 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1R,5S,8S,9S,11S,12S)-5-hydroxy-11,12-dimethyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| SMILES | C=C1C[C@]23C[C@@]1(O)CCC2[C@@]12CC[C@H](C)[C@](C)(C(=O)O1)C2C3C(=O)O |
| InChI | InChI=1S/C20H26O5/c1-10-4-7-20-12-5-6-19(24)9-18(12,8-11(19)2)13(15(21)22)14(20)17(10,3)16(23)25-20/h10,12-14,24H,2,4-9H2,1,3H3,(H,21,22)/t10-,12?,13?,14?,17-,18-,19-,20+/m0/s1 |
| InChIKey | HZEOINOFDCCGJF-FATBXWTLSA-N |
| XLogP | 2.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|