C16H21N3 — CID 105215168
[2-(3,4-dimethylphenyl)-1-(6-methyl-3-pyridinyl)ethyl]hydrazine (PubChem CID 105215168) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-1-(6-methyl-3-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(3,4-dimethylphenyl)-1-(6-methyl-3-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105215168 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-1-(6-methyl-3-pyridinyl)ethyl]hydrazine |
| SMILES | Cc1ccc(C(Cc2ccc(C)c(C)c2)NN)cn1 |
| InChI | InChI=1S/C16H21N3/c1-11-4-6-14(8-12(11)2)9-16(19-17)15-7-5-13(3)18-10-15/h4-8,10,16,19H,9,17H2,1-3H3 |
| InChIKey | QXWDDHQKXYCLIY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|