C11H13ClFN5 — CID 105215350
[1-(2-chloro-4-fluorophenyl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105215350) has the molecular formula C11H13ClFN5 and a molecular weight of 269.71 g/mol. Its IUPAC name is [1-(2-chloro-4-fluorophenyl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(2-chloro-4-fluorophenyl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105215350 |
| Molecular Formula | C11H13ClFN5 |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [1-(2-chloro-4-fluorophenyl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | Cn1ncnc1CC(NN)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H13ClFN5/c1-18-11(15-6-16-18)5-10(17-14)8-3-2-7(13)4-9(8)12/h2-4,6,10,17H,5,14H2,1H3 |
| InChIKey | TWTYXHMXFJGWQZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|