C22H34O3 — CID 10521540
2-[(1R,4E,6E,10E,14R)-1,7,11-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-4-yl]propyl acetate (PubChem CID 10521540) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 2-[(1R,4E,6E,10E,14R)-1,7,11-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-4-yl]propyl acetate.
| Compound Name | 2-[(1R,4E,6E,10E,14R)-1,7,11-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-4-yl]propyl acetate |
|---|---|
| PubChem CID | 10521540 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-[(1R,4E,6E,10E,14R)-1,7,11-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-4-yl]propyl acetate |
| SMILES | CC(=O)OCC(C)/C1=C/C=C(\C)CC/C=C(\C)CC[C@H]2O[C@]2(C)CC1 |
| InChI | InChI=1S/C22H34O3/c1-16-7-6-8-17(2)10-12-21-22(5,25-21)14-13-20(11-9-16)18(3)15-24-19(4)23/h8-9,11,18,21H,6-7,10,12-15H2,1-5H3/b16-9+,17-8+,20-11+/t18?,21-,22-/m1/s1 |
| InChIKey | NPPINIIXKXSEEJ-YIHZAZBXSA-N |
| XLogP | 5.52 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|