C17H34O5Si — CID 10521544
[(2S,3R,4R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate (PubChem CID 10521544) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is [(2S,3R,4R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate.
| Compound Name | [(2S,3R,4R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate |
|---|---|
| PubChem CID | 10521544 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | [(2S,3R,4R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentyl] acetate |
| SMILES | CC(=O)OC[C@H](C)[C@@H](OC(C)=O)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O5Si/c1-12(10-20-14(3)18)16(22-15(4)19)13(2)11-21-23(8,9)17(5,6)7/h12-13,16H,10-11H2,1-9H3/t12-,13+,16+/m0/s1 |
| InChIKey | JFZVAKGIJCDKIZ-WOSRLPQWSA-N |
| XLogP | 3.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|