C24H42O — CID 10521551
(5Z,8Z,11Z,14Z)-1-(2-methylpropoxy)icosa-5,8,11,14-tetraene (PubChem CID 10521551) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-1-(2-methylpropoxy)icosa-5,8,11,14-tetraene.
| Compound Name | (5Z,8Z,11Z,14Z)-1-(2-methylpropoxy)icosa-5,8,11,14-tetraene |
|---|---|
| PubChem CID | 10521551 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-1-(2-methylpropoxy)icosa-5,8,11,14-tetraene |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCOCC(C)C |
| InChI | InChI=1S/C24H42O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-23-24(2)3/h8-9,11-12,14-15,17-18,24H,4-7,10,13,16,19-23H2,1-3H3/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | JCJKYNUFZROTEZ-GKFVBPDJSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|