About 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid
1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid (PubChem CID 10521564) has the molecular formula C16H13NO8
and a molecular weight of 347.28 g/mol. Its IUPAC name is 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid |
| PubChem CID | 10521564 |
| Molecular Formula | C16H13NO8 |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid |
| SMILES | COC(=O)C(C(=O)OC)c1c(C(=O)O)cc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C16H13NO8/c1-24-15(20)13(16(21)25-2)12-9-6-4-3-5-8(9)11(17(22)23)7-10(12)14(18)19/h3-7,13H,1-2H3,(H,18,19) |
| InChIKey | OKXHHSORNQTRRW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid?
The IUPAC name of 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid (CID 10521564) is 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid.
What is the SMILES notation for 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid?
The canonical SMILES for 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid is COC(=O)C(C(=O)OC)c1c(C(=O)O)cc([N+](=O)[O-])c2ccccc12.
What is the InChIKey of 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid?
The InChIKey is OKXHHSORNQTRRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO8/c1-24-15(20)13(16(21)25-2)12-9-6-4-3-5-8(9)11(17(22)23)7-10(12)14(18)19/h3-7,13H,1-2H3,(H,18,19).
What are the key properties of 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid?
1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid has a molecular weight of 347.28 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitronaphthalene-2-carboxylic acid is sourced from PubChem (CID 10521564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).